| Property |
Value |
| dbo:abstract
|
- L'ébastine est un médicament antihistaminique, antagoniste puissant et sélectif du récepteur H1 de l'histamine. (fr)
- L'ébastine est un médicament antihistaminique, antagoniste puissant et sélectif du récepteur H1 de l'histamine. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C32H39NO2/c1-32(2,3)28-18-16-25(17-19-28)30(34)15-10-22-33-23-20-29(21-24-33)35-31(26-11-6-4-7-12-26)27-13-8-5-9-14-27/h4-9,11-14,16-19,29,31H,10,15,20-24H2,1-3H3
|
| dbo:iupacName
|
- 4-(4-benzhydryloxy-1-pipéridyl)-1-(4-tert-butylphényl)butan-1-one (fr)
- 4-(4-benzhydryloxy-1-pipéridyl)-1-(4-tert-butylphényl)butan-1-one (fr)
|
| dbo:smiles
|
- C(c1ccccc1)(c1ccccc1)OC1CCN(CCCC(c2ccc(C(C)(C)C)cc2)=O)CC1
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4137 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:n
| |
| prop-fr:nom
|
- Ébastine (fr)
- Ébastine (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:smiles
|
- COC1CCNCC1 (fr)
- COC1CCNCC1 (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:voieadministration
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- L'ébastine est un médicament antihistaminique, antagoniste puissant et sélectif du récepteur H1 de l'histamine. (fr)
- L'ébastine est un médicament antihistaminique, antagoniste puissant et sélectif du récepteur H1 de l'histamine. (fr)
|
| rdfs:label
|
- Ébastine (fr)
- Ebastina (ca)
- Ebastina (es)
- Ebastina (it)
- Ebastine (en)
- Ебастин (uk)
- エバスチン (ja)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Ébastine (fr)
- Ébastine (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
