| Property |
Value |
| dbo:abstract
|
- L'énanthotoxine ((E,E,E)-heptadéca-2,8,10-triène-4,6,diyne-1,14-diol en nomenclature IUPAC) est un composé chimique organique de formule brut C17H22O2. C’est un alcool hautement insaturé très toxique. (fr)
- L'énanthotoxine ((E,E,E)-heptadéca-2,8,10-triène-4,6,diyne-1,14-diol en nomenclature IUPAC) est un composé chimique organique de formule brut C17H22O2. C’est un alcool hautement insaturé très toxique. (fr)
|
| dbo:alternativeName
|
- œnanthotoxine (fr)
- œnanthotoxine (fr)
|
| dbo:iupacName
|
- (2E,8E,10E)-heptadéca-2,8,10-triène-4,6,diyne-1,14-diol (fr)
- (2E,8E,10E)-heptadéca-2,8,10-triène-4,6,diyne-1,14-diol (fr)
|
| dbo:smiles
|
- OC/C=C/C#CC#C\C=C\C=C\CCC(O)CCC
|
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5404 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:dl
| |
| prop-fr:h
| |
| prop-fr:logp
| |
| prop-fr:nomiupac
|
- -heptadéca-2,8,10-triène-4,6,diyne-1,14-diol (fr)
- -heptadéca-2,8,10-triène-4,6,diyne-1,14-diol (fr)
|
| prop-fr:o
| |
| prop-fr:smiles
|
- OC/C=C/C#CC#C\C=C\C=C\CCCCCC (fr)
- OC/C=C/C#CC#C\C=C\C=C\CCCCCC (fr)
|
| prop-fr:stdinchi
| |
| prop-fr:stdinchikey
|
- UPXPHJXYZGEBCW-JHTNEVNSSA-N (fr)
- UPXPHJXYZGEBCW-JHTNEVNSSA-N (fr)
|
| prop-fr:synonymes
|
- œnanthotoxine (fr)
- œnanthotoxine (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- L'énanthotoxine ((E,E,E)-heptadéca-2,8,10-triène-4,6,diyne-1,14-diol en nomenclature IUPAC) est un composé chimique organique de formule brut C17H22O2. C’est un alcool hautement insaturé très toxique. (fr)
- L'énanthotoxine ((E,E,E)-heptadéca-2,8,10-triène-4,6,diyne-1,14-diol en nomenclature IUPAC) est un composé chimique organique de formule brut C17H22O2. C’est un alcool hautement insaturé très toxique. (fr)
|
| rdfs:label
|
- Enantotoxina (es)
- Oenanthotoxin (en)
- Énanthotoxine (fr)
|
| rdfs:seeAlso
|
- https://tools.wmflabs.org/magnustools/cas.php?cas=20311-78-8
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22UPXPHJXYZGEBCW-SRFVWEJJSA-N%22InChIKey
- http://www.lipidmaps.org/data/LMSDRecord.php?LMID=LMFA05000728
- https://comptox.epa.gov/dashboard/DTXSID60897236
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C17H22O2/c1-2-14-17(19)15-12-10-8-6-4-3-5-7-9-11-13-16-18/h4,6,8,10-11,13,17-19H,2,12,14-16H2,1H3/b6-4+,10-8+,13-11+/t17-/m1/s1
- http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4GD5A2RG2N
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
