| Property |
Value |
| dbo:abstract
|
- Le tétranitrométhane (TNM) est un composé de formule chimique C(NO2)4. (fr)
- Le tétranitrométhane (TNM) est un composé de formule chimique C(NO2)4. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/CN4O8/c6-2(7)1(3(8)9,4(10)11)5(12)13
|
| dbo:pubchem
| |
| dbo:smiles
|
- C([N+](=O)[O-])([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-]
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5914 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:apparence
|
- liquide incolore à jaune, huileux, d'odeur âcre. (fr)
- liquide incolore à jaune, huileux, d'odeur âcre. (fr)
|
| prop-fr:c
| |
| prop-fr:circ
|
- Groupe 2B : Peut-être cancérogène pour l'homme (fr)
- Groupe 2B : Peut-être cancérogène pour l'homme (fr)
|
| prop-fr:image
|
- Tetranitromethane-3D-vdW.png (fr)
- Tetranitromethane-3D-vdW.png (fr)
|
| prop-fr:inchi
| |
| prop-fr:n
| |
| prop-fr:nom
|
- Tétranitrométhane (fr)
- Tétranitrométhane (fr)
|
| prop-fr:o
| |
| prop-fr:pressionvapeur
| |
| prop-fr:pubchem
| |
| prop-fr:r
|
- R8, R45, R23/24/25, R36/38 (fr)
- R8, R45, R23/24/25, R36/38 (fr)
|
| prop-fr:s
|
- S17, S45 (fr)
- S17, S45 (fr)
|
| prop-fr:smiles
|
- C[N+][O-] (fr)
- C[N+][O-] (fr)
|
| prop-fr:solubilite
|
- dans l'eau à : (fr)
- dans l'eau à : (fr)
|
| prop-fr:symboles
| |
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le tétranitrométhane (TNM) est un composé de formule chimique C(NO2)4. (fr)
- Le tétranitrométhane (TNM) est un composé de formule chimique C(NO2)4. (fr)
|
| rdfs:label
|
- Tétranitrométhane (fr)
- Tetranitrometan (sv)
- Tetranitromethaan (nl)
- Tetranitromethane (en)
- Тетранитрометан (ru)
- テトラニトロメタン (ja)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Tétranitrométhane (fr)
- Tétranitrométhane (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
