| Property |
Value |
| dbo:abstract
|
- Le triasulfuron est un herbicide. (fr)
- Le triasulfuron est un herbicide. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C14H16ClN5O5S/c1-9-16-12(19-14(17-9)24-2)18-13(21)20-26(22,23)11-6-4-3-5-10(11)25-8-7-15/h3-6H,7-8H2,1-2H3,(H2,16,17,18,19,20,21)/f/h18,20H
|
| dbo:iupacName
|
- 3-(6-méthoxy-4-méthyl-1,3,5-triazin-2-yl)-1-[2-(2-chloréthoxy)-phénylsulfonyl]-urée (fr)
- 3-(6-méthoxy-4-méthyl-1,3,5-triazin-2-yl)-1-[2-(2-chloréthoxy)-phénylsulfonyl]-urée (fr)
|
| dbo:pubchem
| |
| dbo:smiles
|
- Cc2nc(OC)nc(n2)NC(=O)NS(=O)(=O)c1ccccc1OCCCl
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3790 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:cl
| |
| prop-fr:dl
|
- > rat oral (fr)
- > rat peau (fr)
- > rat oral (fr)
- > rat peau (fr)
|
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:n
| |
| prop-fr:nom
|
- Triasulfuron (fr)
- Triasulfuron (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:pka
| |
| prop-fr:pubchem
| |
| prop-fr:r
| |
| prop-fr:s
|
- 1 (xsd:integer)
- S60, S61 (fr)
|
| prop-fr:smiles
|
- Cc2ncncNCNSc1ccccc1OCCCl (fr)
- Cc2ncncNCNSc1ccccc1OCCCl (fr)
|
| prop-fr:solubilite
| |
| prop-fr:symboles
| |
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le triasulfuron est un herbicide. (fr)
- Le triasulfuron est un herbicide. (fr)
|
| rdfs:label
|
- Triasulfuron (fr)
- Triasulfuron (de)
- Triasulfuron (nl)
- Triasulfuron (fr)
- Triasulfuron (de)
- Triasulfuron (nl)
|
| rdfs:seeAlso
|
- http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=299LHF498M
- http://echa.europa.eu/substance-information/-/substanceinfo/100.119.228
- http://tools.wmflabs.org/wikidata-externalid-url/?p=679&url_prefix=http://gestis-en.itrust.de/nxt/gateway.dll?f=id$t=default.htm$vid=gestiseng:sdbeng$id=&id=531783
- https://tools.wmflabs.org/magnustools/cas.php?cas=82097-50-5
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22XOPFESVZMSQIKC-UHFFFAOYSA-N%22InChIKey
- http://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@DOCNO+8436
- https://comptox.epa.gov/dashboard/DTXSID0024345
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C14H16ClN5O5S/c1-9-16-12(19-14(17-9)24-2)18-13(21)20-26(22,23)11-6-4-3-5-10(11)25-8-7-15/h3-6H,7-8H2,1-2H3,(H2,16,17,18,19,20,21)
- http://chemapps.stolaf.edu/jmol/jmol.php?model=CC1=NC(=NC(=N1)OC)NC(=O)NS(=O)(=O)C2=CC=CC=C2OCCCl
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Triasulfuron (fr)
- Triasulfuron (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
