| Property |
Value |
| dbo:abstract
|
- La prostaglandine F2α (PGF2α), appelée dinoprost en pharmacie, est une prostaglandine naturelle utilisée pour déclencher l'accouchement ainsi que l'avortement. (fr)
- La prostaglandine F2α (PGF2α), appelée dinoprost en pharmacie, est une prostaglandine naturelle utilisée pour déclencher l'accouchement ainsi que l'avortement. (fr)
|
| dbo:alternativeName
|
- Dinoprost (fr)
- Dinoprost (fr)
|
| dbo:einecsNumber
| |
| dbo:iupacName
|
- acide (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-ényl]cyclopentyl]hept-5-énoïque (fr)
- acide (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-ényl]cyclopentyl]hept-5-énoïque (fr)
|
| dbo:smiles
|
- CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1C/C=C\CCCC(=O)O)O)O)O
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 7746 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:chebi
| |
| prop-fr:h
| |
| prop-fr:légende
|
- 175 (xsd:integer)
- Structure de la prostaglandine F2α (fr)
|
| prop-fr:nom
|
- Prostaglandine F2α (fr)
- Prostaglandine F2α (fr)
|
| prop-fr:nomiupac
|
- acide -7-[-3,5-dihydroxy-2-[-3-hydroxyoct-1-ényl]cyclopentyl]hept-5-énoïque (fr)
- acide -7-[-3,5-dihydroxy-2-[-3-hydroxyoct-1-ényl]cyclopentyl]hept-5-énoïque (fr)
|
| prop-fr:o
| |
| prop-fr:smiles
|
- CCCCC[C@@H]O (fr)
- CCCCC[C@@H]O (fr)
|
| prop-fr:stdinchi
| |
| prop-fr:stdinchikey
|
- PXGPLTODNUVGFL-YNNPMVKQSA-N (fr)
- PXGPLTODNUVGFL-YNNPMVKQSA-N (fr)
|
| prop-fr:synonymes
|
- Dinoprost (fr)
- Dinoprost (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- La prostaglandine F2α (PGF2α), appelée dinoprost en pharmacie, est une prostaglandine naturelle utilisée pour déclencher l'accouchement ainsi que l'avortement. (fr)
- La prostaglandine F2α (PGF2α), appelée dinoprost en pharmacie, est une prostaglandine naturelle utilisée pour déclencher l'accouchement ainsi que l'avortement. (fr)
|
| rdfs:label
|
- Prostaglandine F2α (fr)
- Prostaglandin F2α (de)
- Prostaglandina F2α (ca)
- Prostaglandina F2α (it)
- 前列腺素F2α (zh)
- Prostaglandine F2α (fr)
- Prostaglandin F2α (de)
- Prostaglandina F2α (ca)
- Prostaglandina F2α (it)
- 前列腺素F2α (zh)
|
| rdfs:seeAlso
|
- http://echa.europa.eu/substance-information/-/substanceinfo/100.209.720
- http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=1884
- http://www.hmdb.ca/metabolites/HMDB0001139
- https://tools.wmflabs.org/magnustools/cas.php?cas=551-11-1
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22PXGPLTODNUVGFL-YNNPMVKQSA-N%22InChIKey
- http://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@DOCNO+3315
- http://www.lipidmaps.org/data/LMSDRecord.php?LMID=LMFA03010002
- http://www.whocc.no/atc_ddd_index/?code=G02AD01
- http://www.drugbank.ca/drugs/DB12789
- https://comptox.epa.gov/dashboard/DTXSID9022946
- http://bioportal.bioontology.org/ontologies/RXNORM?p=classes&conceptid=3477
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1
- http://chemapps.stolaf.edu/jmol/jmol.php?model=CCCCCC(C=CC1C(CC(C1CC=CCCCC(=O)O)O)O)O
- http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B7IN85G1HY
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Prostaglandine F2α (fr)
- Prostaglandine F2α (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
