| Property |
Value |
| dbo:abstract
|
- La lophophorine est un composé chimique hallucinogène toxique contenu dans le peyotl (lophophora williamsii). Sa consommation peut entraîner hallucinations, céphalées, nausées, palpitations, tétanies et enfin la mort (DL50 mesurée à 15 mg·kg-1 chez le lapin). (fr)
- La lophophorine est un composé chimique hallucinogène toxique contenu dans le peyotl (lophophora williamsii). Sa consommation peut entraîner hallucinations, céphalées, nausées, palpitations, tétanies et enfin la mort (DL50 mesurée à 15 mg·kg-1 chez le lapin). (fr)
|
| dbo:alternativeName
|
- N-méthylanhalonine (fr)
- N-méthylanhalonine (fr)
|
| dbo:inchi
|
- 1S/C13H17NO3/c1-8-11-9(4-5-14(8)2)6-10(15-3)12-13(11)17-7-16-12/h6,8H,4-5,7H2,1-3H3
|
| dbo:iupacName
|
- 4-méthoxy-8,9-diméthyl-7,9-dihydro-6H-[1,3]dioxolo[4,5-h]isoquinoline (fr)
- 4-méthoxy-8,9-diméthyl-7,9-dihydro-6H-[1,3]dioxolo[4,5-h]isoquinoline (fr)
|
| dbo:smiles
|
- CC1C2=C3C(=C(C=C2CCN1C)OC)OCO3
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4333 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:categoriepsycho
|
- Hallucinogène (fr)
- Hallucinogène (fr)
|
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:modeconsommation
|
- Ingestion (fr)
- Ingestion (fr)
|
| prop-fr:n
| |
| prop-fr:nom
|
- Lophophorine (fr)
- Lophophorine (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:smiles
|
- CC1C2=C3COCO3 (fr)
- CC1C2=C3COCO3 (fr)
|
| prop-fr:synonymes
|
- N-méthylanhalonine (fr)
- N-méthylanhalonine (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- La lophophorine est un composé chimique hallucinogène toxique contenu dans le peyotl (lophophora williamsii). Sa consommation peut entraîner hallucinations, céphalées, nausées, palpitations, tétanies et enfin la mort (DL50 mesurée à 15 mg·kg-1 chez le lapin). (fr)
- La lophophorine est un composé chimique hallucinogène toxique contenu dans le peyotl (lophophora williamsii). Sa consommation peut entraîner hallucinations, céphalées, nausées, palpitations, tétanies et enfin la mort (DL50 mesurée à 15 mg·kg-1 chez le lapin). (fr)
|
| rdfs:label
|
- Lophophorine (fr)
- Lophophorine (fr)
|
| rdfs:seeAlso
| |
| rdfs:subClassOf
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Lophophorine (fr)
- Lophophorine (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
