| Property |
Value |
| dbo:abstract
|
- L'hexétidine est un agent antibactérien, antifongique habituellement utilisé pour des applications vétérinaires ou médicales. Il a un effet antiseptique local, déodorant, et lutte contre la plaque dentaire. (fr)
- L'hexétidine est un agent antibactérien, antifongique habituellement utilisé pour des applications vétérinaires ou médicales. Il a un effet antiseptique local, déodorant, et lutte contre la plaque dentaire. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C21H45N3/c1-6-10-12-19(8-3)14-23-16-21(5,22)17-24(18-23)15-20(9-4)13-11-7-2/h19-20H,6-18,22H2,1-5H3
|
| dbo:iupacName
|
- 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine (fr)
- 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine (fr)
|
| dbo:pubchem
| |
| dbo:smiles
|
- C1C(C)(C[N@@](C[C@@H](CC)CCCC)C[N@@]1C[C@@H](CCCC)CC)N
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5789 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:apparence
|
- liquide (fr)
- liquide (fr)
|
| prop-fr:autresnoms
|
- * Hexoral® u. a.
* Drossadin®, Hextril® (fr)
- * Hexoral® u. a.
* Drossadin®, Hextril® (fr)
|
| prop-fr:c
| |
| prop-fr:classetherapeutique
| |
| prop-fr:fusion
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:légende
| |
| prop-fr:n
| |
| prop-fr:nom
|
- Hexétidine (fr)
- Hexétidine (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:pka
| |
| prop-fr:pubchem
| |
| prop-fr:r
|
- R41, R20/21/22 (fr)
- R41, R20/21/22 (fr)
|
| prop-fr:refraction
| |
| prop-fr:s
|
- S26, S45, S24/25, S36/37/39 (fr)
- S26, S45, S24/25, S36/37/39 (fr)
|
| prop-fr:smiles
| |
| prop-fr:solubilite
|
- insol. dans l'eau (fr)
- sol. dans le méthanol, le benzène, le pétrole, l'éther; (fr)
- insol. dans l'eau (fr)
- sol. dans le méthanol, le benzène, le pétrole, l'éther; (fr)
|
| prop-fr:symboles
| |
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- L'hexétidine est un agent antibactérien, antifongique habituellement utilisé pour des applications vétérinaires ou médicales. Il a un effet antiseptique local, déodorant, et lutte contre la plaque dentaire. (fr)
- L'hexétidine est un agent antibactérien, antifongique habituellement utilisé pour des applications vétérinaires ou médicales. Il a un effet antiseptique local, déodorant, et lutte contre la plaque dentaire. (fr)
|
| rdfs:label
|
- Hexétidine (fr)
- Esetidina (it)
- Hexetidina (pt)
- Гексетидин (uk)
- Hexétidine (fr)
- Esetidina (it)
- Hexetidina (pt)
- Гексетидин (uk)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Hexétidine (fr)
- Hexétidine (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
