| Property |
Value |
| dbo:abstract
|
- Le fénazaquin est un acaricide de contact apparu en 1992. (fr)
- Le fénazaquin est un acaricide de contact apparu en 1992. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C20H22N2O/c1-20(2,3)16-10-8-15(9-11-16)12-13-23-19-17-6-4-5-7-18(17)21-14-22-19/h4-11,14H,12-13H2,1-3H3
|
| dbo:pubchem
| |
| dbo:smiles
|
- CC(C)(C)C1=CC=C(C=C1)CCOC2=NC=NC3=CC=CC=C32
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3719 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:apparence
| |
| prop-fr:c
| |
| prop-fr:dl
|
- souris oral (fr)
- souris oral (fr)
|
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:n
| |
| prop-fr:nom
|
- Fénazaquin (fr)
- Fénazaquin (fr)
|
| prop-fr:o
| |
| prop-fr:pubchem
| |
| prop-fr:r
|
- R20, R25, R50/53 (fr)
- R20, R25, R50/53 (fr)
|
| prop-fr:s
|
- S37, S45, S60, S61, S (fr)
- S37, S45, S60, S61, S (fr)
|
| prop-fr:smiles
|
- CCC1=CC=CCCOC2=NC=NC3=CC=CC=C32 (fr)
- CCC1=CC=CCCOC2=NC=NC3=CC=CC=C32 (fr)
|
| prop-fr:solubilite
|
- dans l'eau à (fr)
- dans l'eau à (fr)
|
| prop-fr:symboles
| |
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le fénazaquin est un acaricide de contact apparu en 1992. (fr)
- Le fénazaquin est un acaricide de contact apparu en 1992. (fr)
|
| rdfs:label
|
- Fénazaquin (fr)
- Fenazaquin (de)
- Fénazaquin (fr)
- Fenazaquin (de)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Fénazaquin (fr)
- Fénazaquin (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
