| Property |
Value |
| dbo:abstract
|
- Le flupentixol (Fluanxol) est un antipsychotique typique. (fr)
- Le flupentixol (Fluanxol) est un antipsychotique typique. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1S/C23H25F3N2OS/c24-23(25,26)17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)30-22)5-3-9-27-10-12-28(13-11-27)14-15-29/h1-2,4-8,16,29H,3,9-15H2/b18-5-
|
| dbo:iupacName
|
- (E,Z)-2-[4-[3-[2-(trifluorométhyl)thioxanthén-9-ylidène]propyl]pipérazin-1-yl]éthanol (fr)
- (E,Z)-2-[4-[3-[2-(trifluorométhyl)thioxanthén-9-ylidène]propyl]pipérazin-1-yl]éthanol (fr)
|
| dbo:smiles
|
- FC(F)(F)c2cc1C(\c3c(Sc1cc2)cccc3)=C/CCN4CCN(CCO)CC4
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5645 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:administration
|
- per os ; injection intramusculaire (fr)
- per os ; injection intramusculaire (fr)
|
| prop-fr:c
| |
| prop-fr:classe
| |
| prop-fr:demivieelim
| |
| prop-fr:drugbank
|
- DB00875 (fr)
- DB00875 (fr)
|
| prop-fr:f
| |
| prop-fr:forme
|
- comprimés pelliculés à 0,5, 1, 3 et , solution buvable à 4 %, solution injectable à 2 % et à 10 % (fr)
- comprimés pelliculés à 0,5, 1, 3 et , solution buvable à 4 %, solution injectable à 2 % et à 10 % (fr)
|
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:inchikey
|
- NJMYODHXAKYRHW-DVZOWYKESA-N (fr)
- NJMYODHXAKYRHW-DVZOWYKESA-N (fr)
|
| prop-fr:laboratoire
|
- Lundbeck, Sandoz (fr)
- Lundbeck, Sandoz (fr)
|
| prop-fr:liaisonproteique
| |
| prop-fr:légende
|
- Isomère Z du flupentixol et E-flupentixol (fr)
- Isomère Z du flupentixol et E-flupentixol (fr)
|
| prop-fr:metabolisme
|
- principalement hépatique (fr)
- principalement hépatique (fr)
|
| prop-fr:n
| |
| prop-fr:nom
|
- Flupentixol (fr)
- Flupentixol (fr)
|
| prop-fr:nomGénérique
|
- flupentixol (fr)
- flupentixol (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:nomsCommerciaux
|
- *Deanxit
*Fluanxol (fr)
- *Deanxit
*Fluanxol (fr)
|
| prop-fr:o
| |
| prop-fr:pressionvapeur
| |
| prop-fr:s
| |
| prop-fr:sels
|
- dichlorhydrate ; décanoate (fr)
- dichlorhydrate ; décanoate (fr)
|
| prop-fr:smiles
|
- FCc2cc1C=C/CCN4CCNCC4 (fr)
- FCc2cc1C=C/CCN4CCNCC4 (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:voieadministration
|
- intramusculaire, orale (fr)
- intramusculaire, orale (fr)
|
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le flupentixol (Fluanxol) est un antipsychotique typique. (fr)
- Le flupentixol (Fluanxol) est un antipsychotique typique. (fr)
|
| rdfs:label
|
- Flupentixol (fr)
- Flupentixol (de)
- Flupentixol (en)
- Flupentixol (eu)
- Flupentixol (sv)
- Flupentixolo (it)
- Флупентиксол (ru)
|
| rdfs:seeAlso
| |
| rdfs:subClassOf
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Flupentixol (fr)
- Flupentixol (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
