| Property |
Value |
| dbo:abstract
|
- Le dichlone est un fongicide. (fr)
- Le dichlone est un fongicide. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C10H4Cl2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H
|
| dbo:smiles
|
- C1=CC=C2C(=C1)C(C(=C(C2=O)Cl)Cl)=O
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3441 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:cl
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:nom
|
- Dichlone (fr)
- Dichlone (fr)
|
| prop-fr:o
| |
| prop-fr:r
|
- R22, R36/38, R50/53 (fr)
- R22, R36/38, R50/53 (fr)
|
| prop-fr:s
|
- S, S26, S60, S61 (fr)
- S, S26, S60, S61 (fr)
|
| prop-fr:smiles
|
- C1=CC=C2CC=O (fr)
- C1=CC=C2CC=O (fr)
|
| prop-fr:symboles
| |
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le dichlone est un fongicide. (fr)
- Le dichlone est un fongicide. (fr)
|
| rdfs:label
|
- Dichlone (fr)
- Dichlon (de)
- Dichlone (en)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Dichlone (fr)
- Dichlone (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
