| Property |
Value |
| dbo:abstract
|
- La butylone (βk-MBDB) est un psychostimulant entactogène ou empathogène, généralement considéré comme un nouveau produit de synthèse (NPS). (fr)
- La butylone (βk-MBDB) est un psychostimulant entactogène ou empathogène, généralement considéré comme un nouveau produit de synthèse (NPS). (fr)
|
| dbo:inchi
|
- 1S/C12H15NO3/c1-3-9(13-2)12(14)8-4-5-10-11(6-8)16-7-15-10/h4-6,9,13H,3,7H2,1-
|
| dbo:iupacName
|
- 1-(1,3-benzodioxol-5-yl)-2-(méthylamino)butan-1-one (fr)
- 1-(1,3-benzodioxol-5-yl)-2-(méthylamino)butan-1-one (fr)
|
| dbo:smiles
|
- CCC(NC)C(=O)c1ccc2OCOc2c1
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2603 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:autresnoms
|
- βk-MBDB (fr)
- βk-MBDB (fr)
|
| prop-fr:c
| |
| prop-fr:categoriepsycho
|
- Stimulant entactogène (fr)
- Stimulant entactogène (fr)
|
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:inchikey
| |
| prop-fr:modeconsommation
| |
| prop-fr:n
| |
| prop-fr:nom
|
- Butylone (fr)
- Butylone (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:risquedependance
| |
| prop-fr:smiles
|
- CCCCc1ccc2OCOc2c1 (fr)
- CCCCc1ccc2OCOc2c1 (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- La butylone (βk-MBDB) est un psychostimulant entactogène ou empathogène, généralement considéré comme un nouveau produit de synthèse (NPS). (fr)
- La butylone (βk-MBDB) est un psychostimulant entactogène ou empathogène, généralement considéré comme un nouveau produit de synthèse (NPS). (fr)
|
| rdfs:label
|
- Butylone (fr)
- Butylone (fr)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Butylone (fr)
- Butylone (fr)
|
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
