| Property |
Value |
| dbo:abstract
|
- Le butorphanol est un dérivé agoniste-antagoniste opioïde ayant une activité μ-antagoniste, κ-agoniste et σ-agoniste, contrairement à la plupart des opiacés, lui permettant d'être utilisé comme analgésique. (fr)
- Le butorphanol est un dérivé agoniste-antagoniste opioïde ayant une activité μ-antagoniste, κ-agoniste et σ-agoniste, contrairement à la plupart des opiacés, lui permettant d'être utilisé comme analgésique. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C21H29NO2/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15/h6-7,13,15,19,23-24H,1-5,8-12,14H2/t19-,20+,21-/m1/s1
|
| dbo:iupacName
|
- 17-(cyclobutylméthyl)-morphinane-3,14-diol (fr)
- 17-(cyclobutylméthyl)-morphinane-3,14-diol (fr)
|
| dbo:smiles
|
- c12[C@@]34[C@@]([C@H]([N@@](CC5CCC5)CC3)Cc1ccc(c2)O)(CCCC4)O
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 9814 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:antidote
| |
| prop-fr:apparence
|
- Poudre cristalline blanche • Solution limpide (fr)
- Poudre cristalline blanche • Solution limpide (fr)
|
| prop-fr:c
| |
| prop-fr:classetherapeutique
|
- Antalgique opioïde de palier IIb (fr)
- Antalgique opioïde de palier IIb (fr)
|
| prop-fr:demivieelim
| |
| prop-fr:excretion
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:liaisonproteique
| |
| prop-fr:metabolisme
| |
| prop-fr:n
| |
| prop-fr:nom
|
- Butorphanol (fr)
- Butorphanol (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:smiles
|
- c12[C@@]34[C@@]O (fr)
- c12[C@@]34[C@@]O (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:voieadministration
|
- Voies orale, intraveineuse, intramusculaire et sous-cutanée (fr)
- Voies orale, intraveineuse, intramusculaire et sous-cutanée (fr)
|
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le butorphanol est un dérivé agoniste-antagoniste opioïde ayant une activité μ-antagoniste, κ-agoniste et σ-agoniste, contrairement à la plupart des opiacés, lui permettant d'être utilisé comme analgésique. (fr)
- Le butorphanol est un dérivé agoniste-antagoniste opioïde ayant une activité μ-antagoniste, κ-agoniste et σ-agoniste, contrairement à la plupart des opiacés, lui permettant d'être utilisé comme analgésique. (fr)
|
| rdfs:label
|
- Butorphanol (fr)
- Butorfanol (nl)
- Butorfanol (pl)
- Буторфанол (uk)
- Butorphanol (fr)
- Butorfanol (nl)
- Butorfanol (pl)
- Буторфанол (uk)
|
| rdfs:seeAlso
|
- http://echa.europa.eu/substance-information/-/substanceinfo/100.050.717
- http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7591
- https://tools.wmflabs.org/magnustools/cas.php?cas=42408-82-2
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22IFKLAQQSCNILHL-QHAWAJNXSA-N%22InChIKey
- http://www.whocc.no/atc_ddd_index/?code=N02AF01
- http://www.drugbank.ca/drugs/DB00611
- https://comptox.epa.gov/dashboard/DTXSID1022714
- http://bioportal.bioontology.org/ontologies/RXNORM?p=classes&conceptid=1841
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C21H29NO2/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15/h6-7,13,15,19,23-24H,1-5,8-12,14H2/t19-,20+,21-/m1/s1
- http://chemapps.stolaf.edu/jmol/jmol.php?model=C1CCC2(C3CC4=C(C2(C1)CCN3CC5CCC5)C=C(C=C4)O)O
- http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=QV897JC36D
- http://www.simolecule.com/cdkdepict/depict/bow/svg?smi=C1CCC@2(C@H3CC4=C(C@2(C1)CCN3CC5CCC5)C=C(C=C4)O)O&zoom=2.0&annotate=cip
- https://mor.nlm.nih.gov/RxNav/search?searchBy=NUI&searchTerm=N0000147743
- https://ncim-stage.nci.nih.gov/ncimbrowser/ConceptReport.jsp?dictionary=NCI%20Metathesaurus&code=C0006491
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Butorphanol (fr)
- Butorphanol (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
