| Property |
Value |
| dbo:abstract
|
- La 8-prénylnaringénine, appelée aussi 8-PN ou hopéine, est un flavonoïde prénylé, spécifiquement un prénylflavanone. C'est le plus puissant phytoestrogène connu.La 8-prénylnaringénine est un composé phénolique qui se trouve spécifiquement dans les inflorescences femelles du houblon. (fr)
- La 8-prénylnaringénine, appelée aussi 8-PN ou hopéine, est un flavonoïde prénylé, spécifiquement un prénylflavanone. C'est le plus puissant phytoestrogène connu.La 8-prénylnaringénine est un composé phénolique qui se trouve spécifiquement dans les inflorescences femelles du houblon. (fr)
|
| dbo:inchi
|
- 1S/C20H20O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9,18,21-23H,8,10H2,1-2H3/t18-/m0/s1
|
| dbo:iupacName
|
- (2S)-5,7-dihydroxy-2-(4-hydroxyphényl)-8-(3-méthylbut-2-ényl)-2,3-dihydrochromén-4-one (fr)
- (2S)-5,7-dihydroxy-2-(4-hydroxyphényl)-8-(3-méthylbut-2-ényl)-2,3-dihydrochromén-4-one (fr)
|
| dbo:smiles
|
- CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=CC=C(C=C3)O)O)O)C
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 7031 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:chebi
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:inchikey
|
- LPEPZZAVFJPLNZ-SFHVURJKSA-N (fr)
- LPEPZZAVFJPLNZ-SFHVURJKSA-N (fr)
|
| prop-fr:nom
| |
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:smiles
| |
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- La 8-prénylnaringénine, appelée aussi 8-PN ou hopéine, est un flavonoïde prénylé, spécifiquement un prénylflavanone. C'est le plus puissant phytoestrogène connu.La 8-prénylnaringénine est un composé phénolique qui se trouve spécifiquement dans les inflorescences femelles du houblon. (fr)
- La 8-prénylnaringénine, appelée aussi 8-PN ou hopéine, est un flavonoïde prénylé, spécifiquement un prénylflavanone. C'est le plus puissant phytoestrogène connu.La 8-prénylnaringénine est un composé phénolique qui se trouve spécifiquement dans les inflorescences femelles du houblon. (fr)
|
| rdfs:label
|
- 8-Prenylnaringenin (en)
- 8-prenilnaringenina (es)
- 8-prénylnaringénine (fr)
- ソホラフラバノンB (ja)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- 8-prénylnaringénine (fr)
- 8-prénylnaringénine (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
