| Property |
Value |
| dbo:abstract
|
- L'ayanine est un flavonoïde de type flavonol O-méthylé. Elle est le dérivé 3,7,4'-tri-O-méthylé de la quercétine. Elle peut être trouvée dans Croton schiedeanus ou aussi synthétisée. (fr)
- L'ayanine est un flavonoïde de type flavonol O-méthylé. Elle est le dérivé 3,7,4'-tri-O-méthylé de la quercétine. Elle peut être trouvée dans Croton schiedeanus ou aussi synthétisée. (fr)
|
| dbo:alternativeName
|
- * 3,7,4'-tri-O-méthylquercétine (fr)
- * 3,7,4'-triméthylquercétine (fr)
- * 5,3'-dihydroxy-3,7,4'-triméthoxyflavone (fr)
- * 3,7,4'-tri-O-méthylquercétine (fr)
- * 3,7,4'-triméthylquercétine (fr)
- * 5,3'-dihydroxy-3,7,4'-triméthoxyflavone (fr)
|
| dbo:inchi
|
- 1S/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-13(23-2)11(19)6-9/h4-8,19-20H,1-3H3
|
| dbo:iupacName
|
- 5-hydroxy-2-(3-hydroxy-4-méthoxyphényl)-3,7-diméthoxychromén-4-one (fr)
- 5-hydroxy-2-(3-hydroxy-4-méthoxyphényl)-3,7-diméthoxychromén-4-one (fr)
|
| dbo:smiles
|
- O=C1c3c(O/C(=C1/OC)c2ccc(OC)c(O)c2)cc(OC)cc3O
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5219 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:chebi
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:inchikey
|
- KPCRYSMUMBNTCK-UHFFFAOYSA-N (fr)
- KPCRYSMUMBNTCK-UHFFFAOYSA-N (fr)
|
| prop-fr:nom
|
- Ayanine (fr)
- Ayanine (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:smiles
|
- O=C1c3ccccc3O (fr)
- O=C1c3ccccc3O (fr)
|
| prop-fr:synonymes
|
- * 3,7,4'-tri-O-méthylquercétine (fr)
- * 3,7,4'-triméthylquercétine (fr)
- * 5,3'-dihydroxy-3,7,4'-triméthoxyflavone (fr)
- * 3,7,4'-tri-O-méthylquercétine (fr)
- * 3,7,4'-triméthylquercétine (fr)
- * 5,3'-dihydroxy-3,7,4'-triméthoxyflavone (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- L'ayanine est un flavonoïde de type flavonol O-méthylé. Elle est le dérivé 3,7,4'-tri-O-méthylé de la quercétine. Elle peut être trouvée dans Croton schiedeanus ou aussi synthétisée. (fr)
- L'ayanine est un flavonoïde de type flavonol O-méthylé. Elle est le dérivé 3,7,4'-tri-O-méthylé de la quercétine. Elle peut être trouvée dans Croton schiedeanus ou aussi synthétisée. (fr)
|
| rdfs:label
| |
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Ayanine (fr)
- Ayanine (fr)
|
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
