| Attributes | Values |
|---|
| rdf:type
| |
| rdfs:label
| - 1,2,3,4,6-Pentagalloyl glucose (en)
- 1,2,3,4,6-Pentagalloyl glucose (fr)
- 1,2,3,4,6-ペンタガロイルグルコース (ja)
|
| rdfs:comment
| - Le 1,2,3,4,6-Pentagalloyl glucose (PGG en abrégé) est un gallotanin, un type de tanins hydrolysables. (fr)
|
| rdfs:seeAlso
| |
| sameAs
| - 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
- 1,2,3,4,6-Pentagalloyl glucose
|
| Wikipage page ID
| |
| Wikipage revision ID
| |
| dbo:wikiPageWikiLink
| |
| page length (characters) of wiki page
| |
| EINECS number
| |
| dct:subject
| |
| foaf:name
| - 1,2,3,4,6-Pentagalloyl glucose (fr)
|
| prop-fr:wikiPageUsesTemplate
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| prop-fr:c
| |
| prop-fr:h
| |
| prop-fr:légende
| |
| prop-fr:nom
| |
| prop-fr:o
| |
| prop-fr:smiles
| |
| prop-fr:tailleImage
| |
| prop-fr:solubilite
| |
| prop-fr:absorption
| |
| prop-fr:autres
| |
| prop-fr:fusion
| - Point de sublimation : (fr)
|
| thumbnail
| |
| foaf:isPrimaryTopicOf
| |
| SMILES
| - C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6)O)O)O
|
| weight (g)
| |
| has abstract
| - Le 1,2,3,4,6-Pentagalloyl glucose (PGG en abrégé) est un gallotanin, un type de tanins hydrolysables. (fr)
|
| is dbo:wikiPageWikiLink
of | - dbpedia-fr:Casuarictine
- dbpedia-fr:Cornouiller_officinal
- Gallotannin
- dbpedia-fr:Paeonia_veitchii
- dbpedia-fr:Tanin_hydrolysable
- Tellimagrandin II
- dbpedia-fr:PGG
- dbpedia-fr:Pentagalloyl_glucose
- dbpedia-fr:1,2,3,4,6-Pentagalloyl-glucose
- dbpedia-fr:1,2,3,4,6-Pentagalloyl_beta-D-glucose
- dbpedia-fr:1,2,3,4,6-Pentagalloyl_béta-D-glucose
- dbpedia-fr:1,2,3,4,6-Pentagalloylglucose
- dbpedia-fr:1,2,3,4,6-pentagalloyl-glucose
- dbpedia-fr:1,2,3,4,6-pentagalloyl_glucose
|
| is Wikipage redirect
of | - dbpedia-fr:PGG
- dbpedia-fr:Pentagalloyl_glucose
- dbpedia-fr:1,2,3,4,6-Pentagalloyl-glucose
- dbpedia-fr:1,2,3,4,6-Pentagalloyl_beta-D-glucose
- dbpedia-fr:1,2,3,4,6-Pentagalloyl_béta-D-glucose
- dbpedia-fr:1,2,3,4,6-Pentagalloylglucose
- dbpedia-fr:1,2,3,4,6-pentagalloyl-glucose
- dbpedia-fr:1,2,3,4,6-pentagalloyl_glucose
|
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
![[RDF Data]](/fct/images/sw-rdf-blue.png)
![[cxml]](/fct/images/cxml_doc.png)
![[csv]](/fct/images/csv_doc.png)
![[text]](/fct/images/ntriples_doc.png)
![[turtle]](/fct/images/n3turtle_doc.png)
![[ld+json]](/fct/images/jsonld_doc.png)
![[rdf+json]](/fct/images/json_doc.png)
![[rdf+xml]](/fct/images/xml_doc.png)
![[atom+xml]](/fct/images/atom_doc.png)
![[html]](/fct/images/html_doc.png)
