| Property |
Value |
| dbo:abstract
|
- Le formotérol (noms commerciaux : Foradil, Oxis) est un médicament bêta-2-mimétique, bronchodilatateur. (fr)
- Le formotérol (noms commerciaux : Foradil, Oxis) est un médicament bêta-2-mimétique, bronchodilatateur. (fr)
|
| dbo:casNumber
| |
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/t13-,19+/m0/s1
|
| dbo:iupacName
|
- N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-méthoxyphényl)propan-2-yl]amino}éthyl)phényl]formamide (fr)
- N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-méthoxyphényl)propan-2-yl]amino}éthyl)phényl]formamide (fr)
|
| dbo:smiles
|
- c1(cc(c(O)cc1)NC=O)[C@@H](CN[C@H](Cc1ccc(OC)cc1)C)O
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 6347 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:légende
|
- Énantiomère du formotérol et -formotérol (fr)
- Énantiomère du formotérol et -formotérol (fr)
|
| prop-fr:n
| |
| prop-fr:nom
|
- Formotérol (fr)
- Formotérol (fr)
|
| prop-fr:nomiupac
|
- N-[2-hydroxy-5-phényl]formamide (fr)
- N-[2-hydroxy-5-phényl]formamide (fr)
|
| prop-fr:o
| |
| prop-fr:smiles
|
- c1[C@@H]O (fr)
- c1[C@@H]O (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le formotérol (noms commerciaux : Foradil, Oxis) est un médicament bêta-2-mimétique, bronchodilatateur. (fr)
- Le formotérol (noms commerciaux : Foradil, Oxis) est un médicament bêta-2-mimétique, bronchodilatateur. (fr)
|
| rdfs:label
|
- Formotérol (fr)
- Formoterol (eu)
- Formoterol (pl)
- Formoterol (vi)
- فورموتيرول (ar)
- Formotérol (fr)
- Formoterol (eu)
- Formoterol (pl)
- Formoterol (vi)
- فورموتيرول (ar)
|
| rdfs:seeAlso
|
- http://echa.europa.eu/substance-information/-/substanceinfo/100.131.654
- http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=3465
- https://commons.wikimedia.org/wiki/Category:Formoterol
- https://tools.wmflabs.org/magnustools/cas.php?cas=73573-87-2
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22BPZSYCZIITTYBL-UHFFFAOYSA-N%22InChIKey
- http://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@DOCNO+7287
- http://www.whocc.no/atc_ddd_index/?code=R03AC13
- http://www.drugbank.ca/drugs/DB00983
- https://comptox.epa.gov/dashboard/DTXSID1023077
- http://bioportal.bioontology.org/ontologies/RXNORM?p=classes&conceptid=25255
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)
- http://chemapps.stolaf.edu/jmol/jmol.php?model=CC(CC1=CC=C(C=C1)OC)NCC(C2=CC(=C(C=C2)O)NC=O)O
- http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5ZZ84GCW8B
- https://mor.nlm.nih.gov/RxNav/search?searchBy=NUI&searchTerm=N0000148706
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Formotérol (fr)
- Formotérol (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
