| Property |
Value |
| dbo:abstract
|
- Le diacétoxyscirpenol est une mycotoxine de la famille des trichothécènes. Elle est produite par Fusarium sambucinum. (fr)
- Le diacétoxyscirpenol est une mycotoxine de la famille des trichothécènes. Elle est produite par Fusarium sambucinum. (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C19H26O7/c1-10-5-6-18(8-23-11(2)20)13(7-10)26-16-14(22)15(25-12(3)21)17(18,4)19(16)9-24-19/h7,13-16,22H,5-6,8-9H2,1-4H3/t13-,14-,15-,16-,17-,18-,19-/m1/s1
|
| dbo:iupacName
|
- 4,15-diacétate de 12,13-époxytrichothec-9-ène-3α,4β,15-triol (fr)
- 4,15-diacétate de 12,13-époxytrichothec-9-ène-3α,4β,15-triol (fr)
|
| dbo:smiles
|
- O1[C@@]2([C@@]3([C@@]4(COC(=O)C)CCC(=C[C@H]4O[C@@H]2[C@@H](O)[C@H]3OC(=O)C)C)C)C1
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3989 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:apparence
|
- Poudre blanche (fr)
- Poudre blanche (fr)
|
| prop-fr:c
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:nom
|
- Diacetoxyscirpenol (fr)
- Diacetoxyscirpenol (fr)
|
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:r
|
- R26/27/28, R36/38 (fr)
- R26/27/28, R36/38 (fr)
|
| prop-fr:s
|
- S45, S53 (fr)
- S45, S53 (fr)
|
| prop-fr:smiles
|
- O1[C@@]2C1 (fr)
- O1[C@@]2C1 (fr)
|
| prop-fr:solubilite
|
- Soluble dans le chloroforme, l'éther éthylique, l'acétate d'éthyle et l'acétone (fr)
- Soluble dans le chloroforme, l'éther éthylique, l'acétate d'éthyle et l'acétone (fr)
|
| prop-fr:symboles
| |
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le diacétoxyscirpenol est une mycotoxine de la famille des trichothécènes. Elle est produite par Fusarium sambucinum. (fr)
- Le diacétoxyscirpenol est une mycotoxine de la famille des trichothécènes. Elle est produite par Fusarium sambucinum. (fr)
|
| rdfs:label
|
- Diacetoxyscirpenol (de)
- Diacétoxyscirpenol (fr)
- Diacetoxyscirpenol (de)
- Diacétoxyscirpenol (fr)
|
| rdfs:seeAlso
|
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22AUGQEEXBDZWUJY-ZLJUKNTDSA-N%22InChIKey
- http://echa.europa.eu/substance-information/-/substanceinfo/100.017.159
- https://tools.wmflabs.org/magnustools/cas.php?cas=2270-40-8
- http://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@DOCNO+7244
- https://comptox.epa.gov/dashboard/DTXSID80891791
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C19H26O7/c1-10-5-6-18(8-23-11(2)20)13(7-10)26-16-14(22)15(25-12(3)21)17(18,4)19(16)9-24-19/h7,13-16,22H,5-6,8-9H2,1-4H3/t13-,14-,15-,16-,17-,18-,19-/m1/s1
- http://chemapps.stolaf.edu/jmol/jmol.php?model=CC1=CC2C(CC1)(C3(C(C(C(C34CO4)O2)O)OC(=O)C)C)COC(=O)C
- http://kanaya.naist.jp/knapsack_jsp/information.jsp?sname=C_ID&word=C00003129
- http://www.simolecule.com/cdkdepict/depict/bow/svg?smi=CC1=CC@@H2C@(CC1)(C@3(C@@H(C@H(C@H(C@34CO4)O2)O)OC(=O)C)C)COC(=O)C&zoom=2.0&annotate=cip
- https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=141537&Submit=Submit
- https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=177378&Submit=Submit
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Diacetoxyscirpenol (fr)
- Diacetoxyscirpenol (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
