| Property |
Value |
| dbo:abstract
|
- La 3,3',5-triiodothyronamine, ou plus simplement triiodothyronamine, est une thyronamine issue de la décarboxylation de l'hormone thyroïdienne T3 ou triiodothyronine. (fr)
- La 3,3',5-triiodothyronamine, ou plus simplement triiodothyronamine, est une thyronamine issue de la décarboxylation de l'hormone thyroïdienne T3 ou triiodothyronine. (fr)
|
| dbo:iupacName
|
- 4-[4-(2-aminoéthyl)-2,6-diiodophénoxy]-2-iodophénol (fr)
- 4-[4-(2-aminoéthyl)-2,6-diiodophénoxy]-2-iodophénol (fr)
|
| dbo:smiles
|
- C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CCN)I)I)O
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4527 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:chebi
| |
| prop-fr:h
| |
| prop-fr:i
| |
| prop-fr:légende
| |
| prop-fr:n
| |
| prop-fr:nom
| |
| prop-fr:nomiupac
| |
| prop-fr:o
| |
| prop-fr:smiles
| |
| prop-fr:stdinchi
| |
| prop-fr:stdinchikey
|
- KIXGKGGCXPSNDX-UHFFFAOYSA-N (fr)
- KIXGKGGCXPSNDX-UHFFFAOYSA-N (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- La 3,3',5-triiodothyronamine, ou plus simplement triiodothyronamine, est une thyronamine issue de la décarboxylation de l'hormone thyroïdienne T3 ou triiodothyronine. (fr)
- La 3,3',5-triiodothyronamine, ou plus simplement triiodothyronamine, est une thyronamine issue de la décarboxylation de l'hormone thyroïdienne T3 ou triiodothyronine. (fr)
|
| rdfs:label
|
- 3,3',5-Triiodothyronamine (fr)
- 3,3',5-Triiodothyronamine (fr)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- 3,3',5-Triiodothyronamine (fr)
- 3,3',5-Triiodothyronamine (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
