| Property |
Value |
| dbo:abstract
|
- Le prasugrel est un médicament antiagrégant plaquettaire, vendu sous les noms Efient (Union Européenne) et Effient (États-Unis, Inde). (fr)
- Le prasugrel est un médicament antiagrégant plaquettaire, vendu sous les noms Efient (Union Européenne) et Effient (États-Unis, Inde). (fr)
|
| dbo:alternativeName
|
- acétate de 5-[(RS)-2-cyclopropyl-1-(2-fluorophényl)-2-oxo-éthyl]-6,7-dihydro-4H-thiéno[3,2-c]pyridin-2-yle (fr)
- acétate de 5-[(RS)-2-cyclopropyl-1-(2-fluorophényl)-2-oxo-éthyl]-6,7-dihydro-4H-thiéno[3,2-c]pyridin-2-yle (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C20H20FNO3S/c1-12(23)25-18-10-14-11-22(9-8-17(14)26-18)19(20(24)13-6-7-13)15-4-2-3-5-16(15)21/h2-5,10,13,19H,6-9,11H2,1H3
|
| dbo:iupacName
|
- acétate de 5-[(RS)-2-cyclopropyl-1-(2-fluorophényl)-2-oxoéthyl]-4,5,6,7-tétrahydrothiéno[3,2-c]pyridin-2-yle (fr)
- acétate de 5-[(RS)-2-cyclopropyl-1-(2-fluorophényl)-2-oxoéthyl]-4,5,6,7-tétrahydrothiéno[3,2-c]pyridin-2-yle (fr)
|
| dbo:smiles
|
- CC(=O)Oc1cc2c(s1)CCN(C2)C(c3ccccc3F)C(=O)C4CC4
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 13413 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:f
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:inchikey
|
- DTGLZDAWLRGWQN-UHFFFAOYAR (fr)
- DTGLZDAWLRGWQN-UHFFFAOYAR (fr)
|
| prop-fr:légende
|
- Énantiomère R du prasugrel et S-prasugrel (fr)
- Énantiomère R du prasugrel et S-prasugrel (fr)
|
| prop-fr:n
| |
| prop-fr:nom
|
- prasugrel (fr)
- prasugrel (fr)
|
| prop-fr:nomiupac
|
- acétate de 5-[-2-cyclopropyl-1--2-oxoéthyl]-4,5,6,7-tétrahydrothiéno[3,2-c]pyridin-2-yle (fr)
- acétate de 5-[-2-cyclopropyl-1--2-oxoéthyl]-4,5,6,7-tétrahydrothiéno[3,2-c]pyridin-2-yle (fr)
|
| prop-fr:o
| |
| prop-fr:s
| |
| prop-fr:smiles
|
- CCOc1cc2cCCNCCC4CC4 (fr)
- CCOc1cc2cCCNCCC4CC4 (fr)
|
| prop-fr:stdinchi
| |
| prop-fr:stdinchikey
|
- DTGLZDAWLRGWQN-UHFFFAOYSA-N (fr)
- DTGLZDAWLRGWQN-UHFFFAOYSA-N (fr)
|
| prop-fr:synonymes
|
- acétate de 5-[-2-cyclopropyl-1--2-oxo-éthyl]-6,7-dihydro-4H-thiéno[3,2-c]pyridin-2-yle (fr)
- acétate de 5-[-2-cyclopropyl-1--2-oxo-éthyl]-6,7-dihydro-4H-thiéno[3,2-c]pyridin-2-yle (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le prasugrel est un médicament antiagrégant plaquettaire, vendu sous les noms Efient (Union Européenne) et Effient (États-Unis, Inde). (fr)
- Le prasugrel est un médicament antiagrégant plaquettaire, vendu sous les noms Efient (Union Européenne) et Effient (États-Unis, Inde). (fr)
|
| rdfs:label
|
- Prasugrel (es)
- Prasugrel (fr)
- Prasugrel (es)
- Prasugrel (fr)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- prasugrel (fr)
- prasugrel (fr)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |