| Attributes | Values |
|---|
| rdf:type
| |
| rdfs:label
| |
| rdfs:comment
| - Le cyprosulfamide est un phytoprotecteur utilisé dans les préparations commerciales « Corvus », en combinaison avec les herbicides isoxaflutole et , et « Balance Flexx », en combinaison avec l'herbicide isoxaflutole. Cette préparation est utilisée pour les cultures de maïs. (fr)
|
| rdfs:seeAlso
| - https://tools.wmflabs.org/magnustools/cas.php?cas=221667-31-8
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22OAWUUPVZMNKZRY-UHFFFAOYSA-N%22InChIKey
- https://comptox.epa.gov/dashboard/DTXSID9058022
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C18H18N2O5S/c1-25-16-5-3-2-4-15(16)18(22)20-26(23,24)14-10-6-12(7-11-14)17(21)19-13-8-9-13/h2-7,10-11,13H,8-9H2,1H3,(H,19,21)(H,20,22)
- http://chemapps.stolaf.edu/jmol/jmol.php?model=COC1=CC=CC=C1C(=O)NS(=O)(=O)C2=CC=C(C=C2)C(=O)NC3CC3
- http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Z5J23Y43OL
|
| sameAs
| |
| Wikipage page ID
| |
| Wikipage revision ID
| |
| dbo:wikiPageWikiLink
| |
| page length (characters) of wiki page
| |
| dct:subject
| |
| foaf:name
| |
| prop-fr:wikiPageUsesTemplate
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| prop-fr:c
| |
| prop-fr:h
| |
| prop-fr:n
| |
| prop-fr:nom
| |
| prop-fr:nomiupac
| - N-[4-phenylsulfonyl]-o-anisamide (fr)
|
| prop-fr:o
| |
| prop-fr:smiles
| |
| prop-fr:tailleImage
| |
| prop-fr:inchi
| |
| prop-fr:s
| |
| thumbnail
| |
| foaf:isPrimaryTopicOf
| |
| The IUPAC Internat...emical Identifier
| - 1/C18H18N2O5S/c1-25-16-5-3-2-4-15(16)18(22)20-26(23,24)14-10-6-12(7-11-14)17(21)19-13-8-9-13/h2-7,10-11,13H,8-9H2,1H3,(H,19,21)(H,20,22)/f/h19-20H
|
| IUPAC name
| - N-[4-(cyclopropylcarbamoyl)phenylsulfonyl]-o-anisamide (fr)
|
| SMILES
| - O=C(c1ccc(cc1)S(=O)(=O)NC(=O)c2ccccc2OC)NC3CC3
|
| weight (g)
| |
| has abstract
| - Le cyprosulfamide est un phytoprotecteur utilisé dans les préparations commerciales « Corvus », en combinaison avec les herbicides isoxaflutole et , et « Balance Flexx », en combinaison avec l'herbicide isoxaflutole. Cette préparation est utilisée pour les cultures de maïs. (fr)
|
| is dbo:wikiPageWikiLink
of | |
| is Wikipage redirect
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
![[RDF Data]](/fct/images/sw-rdf-blue.png)
![[cxml]](/fct/images/cxml_doc.png)
![[csv]](/fct/images/csv_doc.png)
![[text]](/fct/images/ntriples_doc.png)
![[turtle]](/fct/images/n3turtle_doc.png)
![[ld+json]](/fct/images/jsonld_doc.png)
![[rdf+json]](/fct/images/json_doc.png)
![[rdf+xml]](/fct/images/xml_doc.png)
![[atom+xml]](/fct/images/atom_doc.png)
![[html]](/fct/images/html_doc.png)
